C16H11F3N2O — CID 41484942
3-(4-cyanophenyl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 41484942) has the molecular formula C16H11F3N2O and a molecular weight of 304.27 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-(4-cyanophenyl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 41484942 |
| Molecular Formula | C16H11F3N2O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-(4-cyanophenyl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | N#Cc1ccc(CCC(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H11F3N2O/c17-12-6-7-13(16(19)15(12)18)21-14(22)8-5-10-1-3-11(9-20)4-2-10/h1-4,6-7H,5,8H2,(H,21,22) |
| InChIKey | XNKBESYCVNGSSK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|