C17H15FN2O — CID 41486884
3-(4-cyanophenyl)-N-(2-fluoro-5-methylphenyl)propanamide (PubChem CID 41486884) has the molecular formula C17H15FN2O and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-N-(2-fluoro-5-methylphenyl)propanamide.
| Compound Name | 3-(4-cyanophenyl)-N-(2-fluoro-5-methylphenyl)propanamide |
|---|---|
| PubChem CID | 41486884 |
| Molecular Formula | C17H15FN2O |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-(4-cyanophenyl)-N-(2-fluoro-5-methylphenyl)propanamide |
| SMILES | Cc1ccc(F)c(NC(=O)CCc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C17H15FN2O/c1-12-2-8-15(18)16(10-12)20-17(21)9-7-13-3-5-14(11-19)6-4-13/h2-6,8,10H,7,9H2,1H3,(H,20,21) |
| InChIKey | FTDQDYJCSRQPPJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |