C17H20N2O — CID 28713053
3-(4-aminophenyl)-N-(2,5-dimethylphenyl)propanamide (PubChem CID 28713053) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-(2,5-dimethylphenyl)propanamide.
| Compound Name | 3-(4-aminophenyl)-N-(2,5-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 28713053 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-(4-aminophenyl)-N-(2,5-dimethylphenyl)propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C17H20N2O/c1-12-3-4-13(2)16(11-12)19-17(20)10-7-14-5-8-15(18)9-6-14/h3-6,8-9,11H,7,10,18H2,1-2H3,(H,19,20) |
| InChIKey | PLWPBCHWWOJORQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|