C21H25NO2 — CID 9314118
N-(2,5-dimethylphenyl)-4-oxo-4-(4-propylphenyl)butanamide (PubChem CID 9314118) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-4-oxo-4-(4-propylphenyl)butanamide.
| Compound Name | N-(2,5-dimethylphenyl)-4-oxo-4-(4-propylphenyl)butanamide |
|---|---|
| PubChem CID | 9314118 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-(2,5-dimethylphenyl)-4-oxo-4-(4-propylphenyl)butanamide |
| SMILES | CCCc1ccc(C(=O)CCC(=O)Nc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C21H25NO2/c1-4-5-17-8-10-18(11-9-17)20(23)12-13-21(24)22-19-14-15(2)6-7-16(19)3/h6-11,14H,4-5,12-13H2,1-3H3,(H,22,24) |
| InChIKey | KIJCPQPCPZNXTE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |