C17H15F2NO2 — CID 9211912
N-(5-fluoro-2-methylphenyl)-4-(4-fluorophenyl)-4-oxobutanamide (PubChem CID 9211912) has the molecular formula C17H15F2NO2 and a molecular weight of 303.31 g/mol. Its IUPAC name is N-(5-fluoro-2-methylphenyl)-4-(4-fluorophenyl)-4-oxobutanamide.
| Compound Name | N-(5-fluoro-2-methylphenyl)-4-(4-fluorophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 9211912 |
| Molecular Formula | C17H15F2NO2 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-(5-fluoro-2-methylphenyl)-4-(4-fluorophenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(F)cc1NC(=O)CCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15F2NO2/c1-11-2-5-14(19)10-15(11)20-17(22)9-8-16(21)12-3-6-13(18)7-4-12/h2-7,10H,8-9H2,1H3,(H,20,22) |
| InChIKey | IGIDALJVKHWMPT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |