C18H18FNO2 — CID 9040199
4-(3,4-dimethylphenyl)-N-(4-fluorophenyl)-4-oxobutanamide (PubChem CID 9040199) has the molecular formula C18H18FNO2 and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-N-(4-fluorophenyl)-4-oxobutanamide.
| Compound Name | 4-(3,4-dimethylphenyl)-N-(4-fluorophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 9040199 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-N-(4-fluorophenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C18H18FNO2/c1-12-3-4-14(11-13(12)2)17(21)9-10-18(22)20-16-7-5-15(19)6-8-16/h3-8,11H,9-10H2,1-2H3,(H,20,22) |
| InChIKey | RJNHRHRGGFIFJP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |