C18H17Cl2NO2 — CID 108796648
N-(3,4-dichlorophenyl)-4-(3,4-dimethylphenyl)-4-oxobutanamide (PubChem CID 108796648) has the molecular formula C18H17Cl2NO2 and a molecular weight of 350.25 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-(3,4-dimethylphenyl)-4-oxobutanamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-(3,4-dimethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 108796648 |
| Molecular Formula | C18H17Cl2NO2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-(3,4-dimethylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2ccc(Cl)c(Cl)c2)cc1C |
| InChI | InChI=1S/C18H17Cl2NO2/c1-11-3-4-13(9-12(11)2)17(22)7-8-18(23)21-14-5-6-15(19)16(20)10-14/h3-6,9-10H,7-8H2,1-2H3,(H,21,23) |
| InChIKey | WSBWIGDONCITOG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |