C17H18FNO — CID 4051768
3-(3,4-dimethylanilino)-1-(4-fluorophenyl)propan-1-one (PubChem CID 4051768) has the molecular formula C17H18FNO and a molecular weight of 271.34 g/mol. Its IUPAC name is 3-(3,4-dimethylanilino)-1-(4-fluorophenyl)propan-1-one.
| Compound Name | 3-(3,4-dimethylanilino)-1-(4-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 4051768 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-(3,4-dimethylanilino)-1-(4-fluorophenyl)propan-1-one |
| SMILES | Cc1ccc(NCCC(=O)c2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C17H18FNO/c1-12-3-8-16(11-13(12)2)19-10-9-17(20)14-4-6-15(18)7-5-14/h3-8,11,19H,9-10H2,1-2H3 |
| InChIKey | KGILTBYBJQDNRK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |