C17H15BrFNO2 — CID 9165178
N-(4-bromo-3-methylphenyl)-4-(4-fluorophenyl)-4-oxobutanamide (PubChem CID 9165178) has the molecular formula C17H15BrFNO2 and a molecular weight of 364.21 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-4-(4-fluorophenyl)-4-oxobutanamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-4-(4-fluorophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 9165178 |
| Molecular Formula | C17H15BrFNO2 |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-4-(4-fluorophenyl)-4-oxobutanamide |
| SMILES | Cc1cc(NC(=O)CCC(=O)c2ccc(F)cc2)ccc1Br |
| InChI | InChI=1S/C17H15BrFNO2/c1-11-10-14(6-7-15(11)18)20-17(22)9-8-16(21)12-2-4-13(19)5-3-12/h2-7,10H,8-9H2,1H3,(H,20,22) |
| InChIKey | DYFOSMDESGPUEO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |