C22H25FN2O2 — CID 55945815
4-(3,4-dimethylphenyl)-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-4-oxobutanamide (PubChem CID 55945815) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-4-oxobutanamide.
| Compound Name | 4-(3,4-dimethylphenyl)-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 55945815 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2ccc(N3CCCC3)c(F)c2)cc1C |
| InChI | InChI=1S/C22H25FN2O2/c1-15-5-6-17(13-16(15)2)21(26)9-10-22(27)24-18-7-8-20(19(23)14-18)25-11-3-4-12-25/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,24,27) |
| InChIKey | NAYMUCWIOYYEND-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|