C18H25FN2O3S — CID 55889543
3-cyclopentylsulfonyl-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 55889543) has the molecular formula C18H25FN2O3S and a molecular weight of 368.47 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | 3-cyclopentylsulfonyl-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 55889543 |
| Molecular Formula | C18H25FN2O3S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3-cyclopentylsulfonyl-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)C1CCCC1)Nc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C18H25FN2O3S/c19-16-13-14(7-8-17(16)21-10-3-4-11-21)20-18(22)9-12-25(23,24)15-5-1-2-6-15/h7-8,13,15H,1-6,9-12H2,(H,20,22) |
| InChIKey | YMCHNPCXTNMVCL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|