C21H29FN2O4S — CID 47047282
N-[5-(3-cyclopentylsulfonylpropanoylamino)-2-fluorophenyl]cyclohexanecarboxamide (PubChem CID 47047282) has the molecular formula C21H29FN2O4S and a molecular weight of 424.54 g/mol. Its IUPAC name is N-[5-(3-cyclopentylsulfonylpropanoylamino)-2-fluorophenyl]cyclohexanecarboxamide.
| Compound Name | N-[5-(3-cyclopentylsulfonylpropanoylamino)-2-fluorophenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 47047282 |
| Molecular Formula | C21H29FN2O4S |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-[5-(3-cyclopentylsulfonylpropanoylamino)-2-fluorophenyl]cyclohexanecarboxamide |
| SMILES | O=C(CCS(=O)(=O)C1CCCC1)Nc1ccc(F)c(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C21H29FN2O4S/c22-18-11-10-16(14-19(18)24-21(26)15-6-2-1-3-7-15)23-20(25)12-13-29(27,28)17-8-4-5-9-17/h10-11,14-15,17H,1-9,12-13H2,(H,23,25)(H,24,26) |
| InChIKey | QADWAYPVBYMBOC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |