C22H32FN3O2 — CID 119711633
N-[2-fluoro-5-(3-piperidin-4-ylbutanoylamino)phenyl]cyclohexanecarboxamide (PubChem CID 119711633) has the molecular formula C22H32FN3O2 and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[2-fluoro-5-(3-piperidin-4-ylbutanoylamino)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[2-fluoro-5-(3-piperidin-4-ylbutanoylamino)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 119711633 |
| Molecular Formula | C22H32FN3O2 |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | N-[2-fluoro-5-(3-piperidin-4-ylbutanoylamino)phenyl]cyclohexanecarboxamide |
| SMILES | CC(CC(=O)Nc1ccc(F)c(NC(=O)C2CCCCC2)c1)C1CCNCC1 |
| InChI | InChI=1S/C22H32FN3O2/c1-15(16-9-11-24-12-10-16)13-21(27)25-18-7-8-19(23)20(14-18)26-22(28)17-5-3-2-4-6-17/h7-8,14-17,24H,2-6,9-13H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | QUTGYXNTAYBDQU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |