C23H28FN3O2 — CID 119723826
N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]-3-piperidin-3-ylbutanamide (PubChem CID 119723826) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119723826 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-[4-fluoro-3-[(2-phenylacetyl)amino]phenyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)Nc1ccc(F)c(NC(=O)Cc2ccccc2)c1)C1CCCNC1 |
| InChI | InChI=1S/C23H28FN3O2/c1-16(18-8-5-11-25-15-18)12-22(28)26-19-9-10-20(24)21(14-19)27-23(29)13-17-6-3-2-4-7-17/h2-4,6-7,9-10,14,16,18,25H,5,8,11-13,15H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | UQNBYJQZBYEZFJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |