C19H28ClFN2O2 — CID 119811125
N-(4-cyclobutyloxy-3-fluorophenyl)-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119811125) has the molecular formula C19H28ClFN2O2 and a molecular weight of 370.90 g/mol. Its IUPAC name is N-(4-cyclobutyloxy-3-fluorophenyl)-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-(4-cyclobutyloxy-3-fluorophenyl)-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119811125 |
| Molecular Formula | C19H28ClFN2O2 |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-(4-cyclobutyloxy-3-fluorophenyl)-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)Nc1ccc(OC2CCC2)c(F)c1)C1CCCNC1.Cl |
| InChI | InChI=1S/C19H27FN2O2.ClH/c1-13(14-4-3-9-21-12-14)10-19(23)22-15-7-8-18(17(20)11-15)24-16-5-2-6-16;/h7-8,11,13-14,16,21H,2-6,9-10,12H2,1H3,(H,22,23);1H |
| InChIKey | BRLRQZIZODWFDF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |