C19H31ClN2O4 — CID 119723367
N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119723367) has the molecular formula C19H31ClN2O4 and a molecular weight of 386.92 g/mol. Its IUPAC name is N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119723367 |
| Molecular Formula | C19H31ClN2O4 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | COCCOc1cc(NC(=O)CC(C)C2CCCNC2)ccc1OC.Cl |
| InChI | InChI=1S/C19H30N2O4.ClH/c1-14(15-5-4-8-20-13-15)11-19(22)21-16-6-7-17(24-3)18(12-16)25-10-9-23-2;/h6-7,12,14-15,20H,4-5,8-11,13H2,1-3H3,(H,21,22);1H |
| InChIKey | ZDJVNHQVKFWUAR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|