C18H28ClN3O4 — CID 119717532
N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119717532) has the molecular formula C18H28ClN3O4 and a molecular weight of 385.89 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119717532 |
| Molecular Formula | C18H28ClN3O4 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[3-(2-amino-2-oxoethoxy)-4-methoxyphenyl]-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)CC(C)C2CCNCC2)cc1OCC(N)=O.Cl |
| InChI | InChI=1S/C18H27N3O4.ClH/c1-12(13-5-7-20-8-6-13)9-18(23)21-14-3-4-15(24-2)16(10-14)25-11-17(19)22;/h3-4,10,12-13,20H,5-9,11H2,1-2H3,(H2,19,22)(H,21,23);1H |
| InChIKey | KVVIBHJFNNPXST-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |