C18H28N2O4 — CID 119808136
3-piperidin-4-yl-N-(2,4,5-trimethoxyphenyl)butanamide (PubChem CID 119808136) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 3-piperidin-4-yl-N-(2,4,5-trimethoxyphenyl)butanamide.
| Compound Name | 3-piperidin-4-yl-N-(2,4,5-trimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 119808136 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-piperidin-4-yl-N-(2,4,5-trimethoxyphenyl)butanamide |
| SMILES | COc1cc(OC)c(OC)cc1NC(=O)CC(C)C1CCNCC1 |
| InChI | InChI=1S/C18H28N2O4/c1-12(13-5-7-19-8-6-13)9-18(21)20-14-10-16(23-3)17(24-4)11-15(14)22-2/h10-13,19H,5-9H2,1-4H3,(H,20,21) |
| InChIKey | UEKUMTVQCWUUSU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |