C18H28N2O3 — CID 119674855
N-[(3,4-dimethoxyphenyl)methyl]-3-piperidin-4-ylbutanamide (PubChem CID 119674855) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-3-piperidin-4-ylbutanamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119674855 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-3-piperidin-4-ylbutanamide |
| SMILES | COc1ccc(CNC(=O)CC(C)C2CCNCC2)cc1OC |
| InChI | InChI=1S/C18H28N2O3/c1-13(15-6-8-19-9-7-15)10-18(21)20-12-14-4-5-16(22-2)17(11-14)23-3/h4-5,11,13,15,19H,6-10,12H2,1-3H3,(H,20,21) |
| InChIKey | CNBYBMIHYMODIX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |