C19H31ClN2O3 — CID 119714575
N-[(4-ethoxy-3-methoxyphenyl)methyl]-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119714575) has the molecular formula C19H31ClN2O3 and a molecular weight of 370.92 g/mol. Its IUPAC name is N-[(4-ethoxy-3-methoxyphenyl)methyl]-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119714575 |
| Molecular Formula | C19H31ClN2O3 |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[(4-ethoxy-3-methoxyphenyl)methyl]-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CCOc1ccc(CNC(=O)CC(C)C2CCCNC2)cc1OC.Cl |
| InChI | InChI=1S/C19H30N2O3.ClH/c1-4-24-17-8-7-15(11-18(17)23-3)12-21-19(22)10-14(2)16-6-5-9-20-13-16;/h7-8,11,14,16,20H,4-6,9-10,12-13H2,1-3H3,(H,21,22);1H |
| InChIKey | XZFRUXKEQZZKQU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |