C23H31ClN2O2 — CID 119712153
N-[(4-phenylmethoxyphenyl)methyl]-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119712153) has the molecular formula C23H31ClN2O2 and a molecular weight of 402.97 g/mol. Its IUPAC name is N-[(4-phenylmethoxyphenyl)methyl]-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-[(4-phenylmethoxyphenyl)methyl]-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119712153 |
| Molecular Formula | C23H31ClN2O2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[(4-phenylmethoxyphenyl)methyl]-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NCc1ccc(OCc2ccccc2)cc1)C1CCCNC1.Cl |
| InChI | InChI=1S/C23H30N2O2.ClH/c1-18(21-8-5-13-24-16-21)14-23(26)25-15-19-9-11-22(12-10-19)27-17-20-6-3-2-4-7-20;/h2-4,6-7,9-12,18,21,24H,5,8,13-17H2,1H3,(H,25,26);1H |
| InChIKey | PKYVCPDJEKFKIS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |