C20H33ClN4O2 — CID 119730353
3-piperidin-3-yl-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]butanamide;hydrochloride (PubChem CID 119730353) has the molecular formula C20H33ClN4O2 and a molecular weight of 396.96 g/mol. Its IUPAC name is 3-piperidin-3-yl-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]butanamide;hydrochloride.
| Compound Name | 3-piperidin-3-yl-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119730353 |
| Molecular Formula | C20H33ClN4O2 |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3-piperidin-3-yl-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]butanamide;hydrochloride |
| SMILES | CC(C)NC(=O)Nc1ccc(CNC(=O)CC(C)C2CCCNC2)cc1.Cl |
| InChI | InChI=1S/C20H32N4O2.ClH/c1-14(2)23-20(26)24-18-8-6-16(7-9-18)12-22-19(25)11-15(3)17-5-4-10-21-13-17;/h6-9,14-15,17,21H,4-5,10-13H2,1-3H3,(H,22,25)(H2,23,24,26);1H |
| InChIKey | WABGXYUEDZQAQO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |