C19H29ClN2O3 — CID 119746508
ethyl 4-[(3-piperidin-3-ylbutanoylamino)methyl]benzoate;hydrochloride (PubChem CID 119746508) has the molecular formula C19H29ClN2O3 and a molecular weight of 368.91 g/mol. Its IUPAC name is ethyl 4-[(3-piperidin-3-ylbutanoylamino)methyl]benzoate;hydrochloride.
| Compound Name | ethyl 4-[(3-piperidin-3-ylbutanoylamino)methyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119746508 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | ethyl 4-[(3-piperidin-3-ylbutanoylamino)methyl]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(CNC(=O)CC(C)C2CCCNC2)cc1.Cl |
| InChI | InChI=1S/C19H28N2O3.ClH/c1-3-24-19(23)16-8-6-15(7-9-16)12-21-18(22)11-14(2)17-5-4-10-20-13-17;/h6-9,14,17,20H,3-5,10-13H2,1-2H3,(H,21,22);1H |
| InChIKey | HFOQKCHVAPKEAD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |