C19H32Cl2N4O — CID 119399577
3-piperidin-3-yl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]butanamide;dihydrochloride (PubChem CID 119399577) has the molecular formula C19H32Cl2N4O and a molecular weight of 403.40 g/mol. Its IUPAC name is 3-piperidin-3-yl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]butanamide;dihydrochloride.
| Compound Name | 3-piperidin-3-yl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119399577 |
| Molecular Formula | C19H32Cl2N4O |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 3-piperidin-3-yl-N-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]butanamide;dihydrochloride |
| SMILES | CC(CC(=O)NCc1ccc(N2CCCC2)nc1)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C19H30N4O.2ClH/c1-15(17-5-4-8-20-14-17)11-19(24)22-13-16-6-7-18(21-12-16)23-9-2-3-10-23;;/h6-7,12,15,17,20H,2-5,8-11,13-14H2,1H3,(H,22,24);2*1H |
| InChIKey | COQGBGNSBKLCHL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |