C14H22Cl2N2OS — CID 119730060
N-[(5-chlorothiophen-2-yl)methyl]-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119730060) has the molecular formula C14H22Cl2N2OS and a molecular weight of 337.32 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119730060 |
| Molecular Formula | C14H22Cl2N2OS |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NCc1ccc(Cl)s1)C1CCCNC1.Cl |
| InChI | InChI=1S/C14H21ClN2OS.ClH/c1-10(11-3-2-6-16-8-11)7-14(18)17-9-12-4-5-13(15)19-12;/h4-5,10-11,16H,2-3,6-9H2,1H3,(H,17,18);1H |
| InChIKey | XZTRZWMMKLSVLI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |