C19H30FN3O — CID 119886350
N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-piperidin-3-ylbutanamide (PubChem CID 119886350) has the molecular formula C19H30FN3O and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119886350 |
| Molecular Formula | C19H30FN3O |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)NCc1ccc(F)c(CN(C)C)c1)C1CCCNC1 |
| InChI | InChI=1S/C19H30FN3O/c1-14(16-5-4-8-21-12-16)9-19(24)22-11-15-6-7-18(20)17(10-15)13-23(2)3/h6-7,10,14,16,21H,4-5,8-9,11-13H2,1-3H3,(H,22,24) |
| InChIKey | ULWFBLOMAMPQLB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |