C14H24Cl2FN3O — CID 119886373
3-amino-N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]butanamide;dihydrochloride (PubChem CID 119886373) has the molecular formula C14H24Cl2FN3O and a molecular weight of 340.27 g/mol. Its IUPAC name is 3-amino-N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]butanamide;dihydrochloride.
| Compound Name | 3-amino-N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119886373 |
| Molecular Formula | C14H24Cl2FN3O |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 3-amino-N-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]butanamide;dihydrochloride |
| SMILES | CC(N)CC(=O)NCc1ccc(F)c(CN(C)C)c1.Cl.Cl |
| InChI | InChI=1S/C14H22FN3O.2ClH/c1-10(16)6-14(19)17-8-11-4-5-13(15)12(7-11)9-18(2)3;;/h4-5,7,10H,6,8-9,16H2,1-3H3,(H,17,19);2*1H |
| InChIKey | DDBQRCCXCRNNLC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |