C13H20FN3O2 — CID 111412022
1-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-(2-hydroxyethyl)urea (PubChem CID 111412022) has the molecular formula C13H20FN3O2 and a molecular weight of 269.32 g/mol. Its IUPAC name is 1-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 111412022 |
| Molecular Formula | C13H20FN3O2 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-(2-hydroxyethyl)urea |
| SMILES | CN(C)Cc1cc(CNC(=O)NCCO)ccc1F |
| InChI | InChI=1S/C13H20FN3O2/c1-17(2)9-11-7-10(3-4-12(11)14)8-16-13(19)15-5-6-18/h3-4,7,18H,5-6,8-9H2,1-2H3,(H2,15,16,19) |
| InChIKey | ZVTSZPUFZLHRIZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |