C11H14F2N2O2 — CID 111573173
1-[2-(2,5-difluorophenyl)ethyl]-3-(2-hydroxyethyl)urea (PubChem CID 111573173) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)ethyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[2-(2,5-difluorophenyl)ethyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 111573173 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)ethyl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)NCCc1cc(F)ccc1F |
| InChI | InChI=1S/C11H14F2N2O2/c12-9-1-2-10(13)8(7-9)3-4-14-11(17)15-5-6-16/h1-2,7,16H,3-6H2,(H2,14,15,17) |
| InChIKey | GPASBLGWFDDNEU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |