C11H13F2NO2 — CID 110902844
3-(2,5-difluorophenyl)-N-(2-hydroxyethyl)propanamide (PubChem CID 110902844) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-N-(2-hydroxyethyl)propanamide.
| Compound Name | 3-(2,5-difluorophenyl)-N-(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 110902844 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-(2,5-difluorophenyl)-N-(2-hydroxyethyl)propanamide |
| SMILES | O=C(CCc1cc(F)ccc1F)NCCO |
| InChI | InChI=1S/C11H13F2NO2/c12-9-2-3-10(13)8(7-9)1-4-11(16)14-5-6-15/h2-3,7,15H,1,4-6H2,(H,14,16) |
| InChIKey | AVJCDDYIVZWZJZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |