C17H17F2NO2 — CID 110922795
3-(2,5-difluorophenyl)-N-[4-(2-hydroxyethyl)phenyl]propanamide (PubChem CID 110922795) has the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-N-[4-(2-hydroxyethyl)phenyl]propanamide.
| Compound Name | 3-(2,5-difluorophenyl)-N-[4-(2-hydroxyethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 110922795 |
| Molecular Formula | C17H17F2NO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-(2,5-difluorophenyl)-N-[4-(2-hydroxyethyl)phenyl]propanamide |
| SMILES | O=C(CCc1cc(F)ccc1F)Nc1ccc(CCO)cc1 |
| InChI | InChI=1S/C17H17F2NO2/c18-14-4-7-16(19)13(11-14)3-8-17(22)20-15-5-1-12(2-6-15)9-10-21/h1-2,4-7,11,21H,3,8-10H2,(H,20,22) |
| InChIKey | OLYXLCAROLWSCD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |