C14H17F2NO3 — CID 119234208
5-[3-(2,5-difluorophenyl)propanoylamino]pentanoic acid (PubChem CID 119234208) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 5-[3-(2,5-difluorophenyl)propanoylamino]pentanoic acid.
| Compound Name | 5-[3-(2,5-difluorophenyl)propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 119234208 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-[3-(2,5-difluorophenyl)propanoylamino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)CCc1cc(F)ccc1F |
| InChI | InChI=1S/C14H17F2NO3/c15-11-5-6-12(16)10(9-11)4-7-13(18)17-8-2-1-3-14(19)20/h5-6,9H,1-4,7-8H2,(H,17,18)(H,19,20) |
| InChIKey | CWXCICWTYLKYOW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|