C17H24ClF3N2O — CID 119696658
3-piperidin-4-yl-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide;hydrochloride (PubChem CID 119696658) has the molecular formula C17H24ClF3N2O and a molecular weight of 364.84 g/mol. Its IUPAC name is 3-piperidin-4-yl-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide;hydrochloride.
| Compound Name | 3-piperidin-4-yl-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119696658 |
| Molecular Formula | C17H24ClF3N2O |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-piperidin-4-yl-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide;hydrochloride |
| SMILES | CC(CC(=O)NCc1ccc(C(F)(F)F)cc1)C1CCNCC1.Cl |
| InChI | InChI=1S/C17H23F3N2O.ClH/c1-12(14-6-8-21-9-7-14)10-16(23)22-11-13-2-4-15(5-3-13)17(18,19)20;/h2-5,12,14,21H,6-11H2,1H3,(H,22,23);1H |
| InChIKey | WLCQJVOFYDUSNA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |