C19H28ClF3N2O — CID 119733513
3-piperidin-4-yl-N-[1-[4-(trifluoromethyl)phenyl]propan-2-yl]butanamide;hydrochloride (PubChem CID 119733513) has the molecular formula C19H28ClF3N2O and a molecular weight of 392.89 g/mol. Its IUPAC name is 3-piperidin-4-yl-N-[1-[4-(trifluoromethyl)phenyl]propan-2-yl]butanamide;hydrochloride.
| Compound Name | 3-piperidin-4-yl-N-[1-[4-(trifluoromethyl)phenyl]propan-2-yl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119733513 |
| Molecular Formula | C19H28ClF3N2O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-piperidin-4-yl-N-[1-[4-(trifluoromethyl)phenyl]propan-2-yl]butanamide;hydrochloride |
| SMILES | CC(Cc1ccc(C(F)(F)F)cc1)NC(=O)CC(C)C1CCNCC1.Cl |
| InChI | InChI=1S/C19H27F3N2O.ClH/c1-13(16-7-9-23-10-8-16)11-18(25)24-14(2)12-15-3-5-17(6-4-15)19(20,21)22;/h3-6,13-14,16,23H,7-12H2,1-2H3,(H,24,25);1H |
| InChIKey | NATLRTPPHKMITK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |