C20H33ClN2O — CID 119772626
N-(1-phenylpentan-2-yl)-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119772626) has the molecular formula C20H33ClN2O and a molecular weight of 352.95 g/mol. Its IUPAC name is N-(1-phenylpentan-2-yl)-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-(1-phenylpentan-2-yl)-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119772626 |
| Molecular Formula | C20H33ClN2O |
| Molecular Weight | 352.95 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N-(1-phenylpentan-2-yl)-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CCCC(Cc1ccccc1)NC(=O)CC(C)C1CCNCC1.Cl |
| InChI | InChI=1S/C20H32N2O.ClH/c1-3-7-19(15-17-8-5-4-6-9-17)22-20(23)14-16(2)18-10-12-21-13-11-18;/h4-6,8-9,16,18-19,21H,3,7,10-15H2,1-2H3,(H,22,23);1H |
| InChIKey | QSOYNEMNVOJFSU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.95 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |