C22H39Cl2N3O — CID 119849977
N-[2-(diethylamino)-3-phenylpropyl]-3-piperidin-4-ylbutanamide;dihydrochloride (PubChem CID 119849977) has the molecular formula C22H39Cl2N3O and a molecular weight of 432.48 g/mol. Its IUPAC name is N-[2-(diethylamino)-3-phenylpropyl]-3-piperidin-4-ylbutanamide;dihydrochloride.
| Compound Name | N-[2-(diethylamino)-3-phenylpropyl]-3-piperidin-4-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119849977 |
| Molecular Formula | C22H39Cl2N3O |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | N-[2-(diethylamino)-3-phenylpropyl]-3-piperidin-4-ylbutanamide;dihydrochloride |
| SMILES | CCN(CC)C(CNC(=O)CC(C)C1CCNCC1)Cc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C22H37N3O.2ClH/c1-4-25(5-2)21(16-19-9-7-6-8-10-19)17-24-22(26)15-18(3)20-11-13-23-14-12-20;;/h6-10,18,20-21,23H,4-5,11-17H2,1-3H3,(H,24,26);2*1H |
| InChIKey | XDDSAEHINOVPNE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |