C18H28N2O4 — CID 119761607
3-piperidin-3-yl-N-(2,3,4-trimethoxyphenyl)butanamide (PubChem CID 119761607) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 3-piperidin-3-yl-N-(2,3,4-trimethoxyphenyl)butanamide.
| Compound Name | 3-piperidin-3-yl-N-(2,3,4-trimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 119761607 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-piperidin-3-yl-N-(2,3,4-trimethoxyphenyl)butanamide |
| SMILES | COc1ccc(NC(=O)CC(C)C2CCCNC2)c(OC)c1OC |
| InChI | InChI=1S/C18H28N2O4/c1-12(13-6-5-9-19-11-13)10-16(21)20-14-7-8-15(22-2)18(24-4)17(14)23-3/h7-8,12-13,19H,5-6,9-11H2,1-4H3,(H,20,21) |
| InChIKey | BOOPJYLQGJNWLC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |