C16H22F2N2O2 — CID 119725624
N-(3,5-difluoro-4-methoxyphenyl)-3-piperidin-3-ylbutanamide (PubChem CID 119725624) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is N-(3,5-difluoro-4-methoxyphenyl)-3-piperidin-3-ylbutanamide.
| Compound Name | N-(3,5-difluoro-4-methoxyphenyl)-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119725624 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-(3,5-difluoro-4-methoxyphenyl)-3-piperidin-3-ylbutanamide |
| SMILES | COc1c(F)cc(NC(=O)CC(C)C2CCCNC2)cc1F |
| InChI | InChI=1S/C16H22F2N2O2/c1-10(11-4-3-5-19-9-11)6-15(21)20-12-7-13(17)16(22-2)14(18)8-12/h7-8,10-11,19H,3-6,9H2,1-2H3,(H,20,21) |
| InChIKey | PEGUDAVSKPKYFR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |