C16H20F4N2O — CID 119709850
N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-piperidin-3-ylbutanamide (PubChem CID 119709850) has the molecular formula C16H20F4N2O and a molecular weight of 332.34 g/mol. Its IUPAC name is N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119709850 |
| Molecular Formula | C16H20F4N2O |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)Nc1ccc(F)c(C(F)(F)F)c1)C1CCCNC1 |
| InChI | InChI=1S/C16H20F4N2O/c1-10(11-3-2-6-21-9-11)7-15(23)22-12-4-5-14(17)13(8-12)16(18,19)20/h4-5,8,10-11,21H,2-3,6-7,9H2,1H3,(H,22,23) |
| InChIKey | GXWDYXHRBQRKKB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |