C17H26N4O3 — CID 119779708
N-[4-(carbamoylamino)-3-methoxyphenyl]-3-piperidin-3-ylbutanamide (PubChem CID 119779708) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[4-(carbamoylamino)-3-methoxyphenyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[4-(carbamoylamino)-3-methoxyphenyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119779708 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-[4-(carbamoylamino)-3-methoxyphenyl]-3-piperidin-3-ylbutanamide |
| SMILES | COc1cc(NC(=O)CC(C)C2CCCNC2)ccc1NC(N)=O |
| InChI | InChI=1S/C17H26N4O3/c1-11(12-4-3-7-19-10-12)8-16(22)20-13-5-6-14(21-17(18)23)15(9-13)24-2/h5-6,9,11-12,19H,3-4,7-8,10H2,1-2H3,(H,20,22)(H3,18,21,23) |
| InChIKey | UNOYFELTFXJFNI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |