C17H19Cl2FN2O2 — CID 78888966
N-[5-[(2,2-dichlorocyclopropanecarbonyl)amino]-2-fluorophenyl]cyclohexanecarboxamide (PubChem CID 78888966) has the molecular formula C17H19Cl2FN2O2 and a molecular weight of 373.26 g/mol. Its IUPAC name is N-[5-[(2,2-dichlorocyclopropanecarbonyl)amino]-2-fluorophenyl]cyclohexanecarboxamide.
| Compound Name | N-[5-[(2,2-dichlorocyclopropanecarbonyl)amino]-2-fluorophenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 78888966 |
| Molecular Formula | C17H19Cl2FN2O2 |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-[5-[(2,2-dichlorocyclopropanecarbonyl)amino]-2-fluorophenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1cc(NC(=O)C2CC2(Cl)Cl)ccc1F)C1CCCCC1 |
| InChI | InChI=1S/C17H19Cl2FN2O2/c18-17(19)9-12(17)16(24)21-11-6-7-13(20)14(8-11)22-15(23)10-4-2-1-3-5-10/h6-8,10,12H,1-5,9H2,(H,21,24)(H,22,23) |
| InChIKey | UAUSCBUYODXCJC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|