C21H22F2N2O2 — CID 55722774
N-[3-(cyclohexanecarbonylamino)-4-fluorophenyl]-3-fluoro-4-methylbenzamide (PubChem CID 55722774) has the molecular formula C21H22F2N2O2 and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[3-(cyclohexanecarbonylamino)-4-fluorophenyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[3-(cyclohexanecarbonylamino)-4-fluorophenyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 55722774 |
| Molecular Formula | C21H22F2N2O2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-[3-(cyclohexanecarbonylamino)-4-fluorophenyl]-3-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(F)c(NC(=O)C3CCCCC3)c2)cc1F |
| InChI | InChI=1S/C21H22F2N2O2/c1-13-7-8-15(11-18(13)23)21(27)24-16-9-10-17(22)19(12-16)25-20(26)14-5-3-2-4-6-14/h7-12,14H,2-6H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | NGDQLDSPHBYDGY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |