C22H30FN3O3 — CID 55776993
N-[5-[(2-acetamido-2-cyclopentylacetyl)amino]-2-fluorophenyl]cyclohexanecarboxamide (PubChem CID 55776993) has the molecular formula C22H30FN3O3 and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[5-[(2-acetamido-2-cyclopentylacetyl)amino]-2-fluorophenyl]cyclohexanecarboxamide.
| Compound Name | N-[5-[(2-acetamido-2-cyclopentylacetyl)amino]-2-fluorophenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 55776993 |
| Molecular Formula | C22H30FN3O3 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[5-[(2-acetamido-2-cyclopentylacetyl)amino]-2-fluorophenyl]cyclohexanecarboxamide |
| SMILES | CC(=O)NC(C(=O)Nc1ccc(F)c(NC(=O)C2CCCCC2)c1)C1CCCC1 |
| InChI | InChI=1S/C22H30FN3O3/c1-14(27)24-20(15-7-5-6-8-15)22(29)25-17-11-12-18(23)19(13-17)26-21(28)16-9-3-2-4-10-16/h11-13,15-16,20H,2-10H2,1H3,(H,24,27)(H,25,29)(H,26,28) |
| InChIKey | LDQPEOJZSADXFZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |