C21H24FN3O4 — CID 47057222
N-[1-[3-(cyclohexanecarbonylamino)-4-fluoroanilino]-1-oxopropan-2-yl]furan-3-carboxamide (PubChem CID 47057222) has the molecular formula C21H24FN3O4 and a molecular weight of 401.44 g/mol. Its IUPAC name is N-[1-[3-(cyclohexanecarbonylamino)-4-fluoroanilino]-1-oxopropan-2-yl]furan-3-carboxamide.
| Compound Name | N-[1-[3-(cyclohexanecarbonylamino)-4-fluoroanilino]-1-oxopropan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 47057222 |
| Molecular Formula | C21H24FN3O4 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[1-[3-(cyclohexanecarbonylamino)-4-fluoroanilino]-1-oxopropan-2-yl]furan-3-carboxamide |
| SMILES | CC(NC(=O)c1ccoc1)C(=O)Nc1ccc(F)c(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C21H24FN3O4/c1-13(23-21(28)15-9-10-29-12-15)19(26)24-16-7-8-17(22)18(11-16)25-20(27)14-5-3-2-4-6-14/h7-14H,2-6H2,1H3,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | IOLKNOJVMDTDNV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |