C20H29FN2O2S — CID 55925288
N-[5-(2-butylsulfanylpropanoylamino)-2-fluorophenyl]cyclohexanecarboxamide (PubChem CID 55925288) has the molecular formula C20H29FN2O2S and a molecular weight of 380.53 g/mol. Its IUPAC name is N-[5-(2-butylsulfanylpropanoylamino)-2-fluorophenyl]cyclohexanecarboxamide.
| Compound Name | N-[5-(2-butylsulfanylpropanoylamino)-2-fluorophenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 55925288 |
| Molecular Formula | C20H29FN2O2S |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N-[5-(2-butylsulfanylpropanoylamino)-2-fluorophenyl]cyclohexanecarboxamide |
| SMILES | CCCCSC(C)C(=O)Nc1ccc(F)c(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C20H29FN2O2S/c1-3-4-12-26-14(2)19(24)22-16-10-11-17(21)18(13-16)23-20(25)15-8-6-5-7-9-15/h10-11,13-15H,3-9,12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | GMVUOYKDTOOGIA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|