C16H23ClN2O3S — CID 51124450
N-[3-chloro-4-(dimethylamino)phenyl]-3-cyclopentylsulfonylpropanamide (PubChem CID 51124450) has the molecular formula C16H23ClN2O3S and a molecular weight of 358.89 g/mol. Its IUPAC name is N-[3-chloro-4-(dimethylamino)phenyl]-3-cyclopentylsulfonylpropanamide.
| Compound Name | N-[3-chloro-4-(dimethylamino)phenyl]-3-cyclopentylsulfonylpropanamide |
|---|---|
| PubChem CID | 51124450 |
| Molecular Formula | C16H23ClN2O3S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[3-chloro-4-(dimethylamino)phenyl]-3-cyclopentylsulfonylpropanamide |
| SMILES | CN(C)c1ccc(NC(=O)CCS(=O)(=O)C2CCCC2)cc1Cl |
| InChI | InChI=1S/C16H23ClN2O3S/c1-19(2)15-8-7-12(11-14(15)17)18-16(20)9-10-23(21,22)13-5-3-4-6-13/h7-8,11,13H,3-6,9-10H2,1-2H3,(H,18,20) |
| InChIKey | SJUSECRJNYNINS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|