C22H32N2O4S — CID 55920389
N-cyclohexyl-4-(3-cyclopentylsulfonylpropanoylamino)-N-methylbenzamide (PubChem CID 55920389) has the molecular formula C22H32N2O4S and a molecular weight of 420.58 g/mol. Its IUPAC name is N-cyclohexyl-4-(3-cyclopentylsulfonylpropanoylamino)-N-methylbenzamide.
| Compound Name | N-cyclohexyl-4-(3-cyclopentylsulfonylpropanoylamino)-N-methylbenzamide |
|---|---|
| PubChem CID | 55920389 |
| Molecular Formula | C22H32N2O4S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-cyclohexyl-4-(3-cyclopentylsulfonylpropanoylamino)-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(NC(=O)CCS(=O)(=O)C2CCCC2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H32N2O4S/c1-24(19-7-3-2-4-8-19)22(26)17-11-13-18(14-12-17)23-21(25)15-16-29(27,28)20-9-5-6-10-20/h11-14,19-20H,2-10,15-16H2,1H3,(H,23,25) |
| InChIKey | WDVHKSSYTRQVRV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |