C24H28BrN3O3 — CID 60549241
4-[3-[(4-bromobenzoyl)amino]propanoylamino]-N-cyclohexyl-N-methylbenzamide (PubChem CID 60549241) has the molecular formula C24H28BrN3O3 and a molecular weight of 486.41 g/mol. Its IUPAC name is 4-[3-[(4-bromobenzoyl)amino]propanoylamino]-N-cyclohexyl-N-methylbenzamide.
| Compound Name | 4-[3-[(4-bromobenzoyl)amino]propanoylamino]-N-cyclohexyl-N-methylbenzamide |
|---|---|
| PubChem CID | 60549241 |
| Molecular Formula | C24H28BrN3O3 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 4-[3-[(4-bromobenzoyl)amino]propanoylamino]-N-cyclohexyl-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(NC(=O)CCNC(=O)c2ccc(Br)cc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C24H28BrN3O3/c1-28(21-5-3-2-4-6-21)24(31)18-9-13-20(14-10-18)27-22(29)15-16-26-23(30)17-7-11-19(25)12-8-17/h7-14,21H,2-6,15-16H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | VCMKBOYBTIUGDT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |