C23H30ClN3O2 — CID 119950414
4-[(3-amino-3-phenylpropanoyl)amino]-N-cyclohexyl-N-methylbenzamide;hydrochloride (PubChem CID 119950414) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 4-[(3-amino-3-phenylpropanoyl)amino]-N-cyclohexyl-N-methylbenzamide;hydrochloride.
| Compound Name | 4-[(3-amino-3-phenylpropanoyl)amino]-N-cyclohexyl-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119950414 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-[(3-amino-3-phenylpropanoyl)amino]-N-cyclohexyl-N-methylbenzamide;hydrochloride |
| SMILES | CN(C(=O)c1ccc(NC(=O)CC(N)c2ccccc2)cc1)C1CCCCC1.Cl |
| InChI | InChI=1S/C23H29N3O2.ClH/c1-26(20-10-6-3-7-11-20)23(28)18-12-14-19(15-13-18)25-22(27)16-21(24)17-8-4-2-5-9-17;/h2,4-5,8-9,12-15,20-21H,3,6-7,10-11,16,24H2,1H3,(H,25,27);1H |
| InChIKey | XVYHFONHBUFQLQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |