C26H35N3O2 — CID 56580229
N-cyclohexyl-4-[[2-(diethylamino)-2-phenylacetyl]amino]-N-methylbenzamide (PubChem CID 56580229) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-cyclohexyl-4-[[2-(diethylamino)-2-phenylacetyl]amino]-N-methylbenzamide.
| Compound Name | N-cyclohexyl-4-[[2-(diethylamino)-2-phenylacetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 56580229 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | N-cyclohexyl-4-[[2-(diethylamino)-2-phenylacetyl]amino]-N-methylbenzamide |
| SMILES | CCN(CC)C(C(=O)Nc1ccc(C(=O)N(C)C2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H35N3O2/c1-4-29(5-2)24(20-12-8-6-9-13-20)25(30)27-22-18-16-21(17-19-22)26(31)28(3)23-14-10-7-11-15-23/h6,8-9,12-13,16-19,23-24H,4-5,7,10-11,14-15H2,1-3H3,(H,27,30) |
| InChIKey | KERVFGXTNAOWKC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |